C26H33N3O6 — CID 24773239
methyl 4-[cyclohexyl-[2-(cyclohexylamino)-1-(furan-2-yl)-2-oxoethyl]amino]-3-nitrobenzoate (PubChem CID 24773239) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl 4-[cyclohexyl-[2-(cyclohexylamino)-1-(furan-2-yl)-2-oxoethyl]amino]-3-nitrobenzoate.
| Compound Name | methyl 4-[cyclohexyl-[2-(cyclohexylamino)-1-(furan-2-yl)-2-oxoethyl]amino]-3-nitrobenzoate |
|---|---|
| PubChem CID | 24773239 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | methyl 4-[cyclohexyl-[2-(cyclohexylamino)-1-(furan-2-yl)-2-oxoethyl]amino]-3-nitrobenzoate |
| SMILES | COC(=O)c1ccc(N(C2CCCCC2)C(C(=O)NC2CCCCC2)c2ccco2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H33N3O6/c1-34-26(31)18-14-15-21(22(17-18)29(32)33)28(20-11-6-3-7-12-20)24(23-13-8-16-35-23)25(30)27-19-9-4-2-5-10-19/h8,13-17,19-20,24H,2-7,9-12H2,1H3,(H,27,30) |
| InChIKey | RSEUJYKZILJKAH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|