C22H41NO11 — CID 101447673
N-[3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxypropyl]octanamide (PubChem CID 101447673) has the molecular formula C22H41NO11 and a molecular weight of 495.57 g/mol. Its IUPAC name is N-[3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxypropyl]octanamide.
| Compound Name | N-[3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxypropyl]octanamide |
|---|---|
| PubChem CID | 101447673 |
| Molecular Formula | C22H41NO11 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | N-[3-[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxypropyl]octanamide |
| SMILES | CCCCCCCC(=O)NCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[C@H]2OC[C@@H](O)[C@H](O)[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C22H41NO11/c1-2-3-4-5-6-8-15(26)23-9-7-10-31-22-19(30)20(17(28)14(11-24)33-22)34-21-18(29)16(27)13(25)12-32-21/h13-14,16-22,24-25,27-30H,2-12H2,1H3,(H,23,26)/t13-,14-,16+,17-,18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | LIMIBNQOTOOBME-VGFOJUCWSA-N |
| XLogP | -1.87 |
| TPSA | 187.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|