C8H13NO3 — CID 101448339
(1R,2S,8R)-2-hydroxy-1-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 101448339) has the molecular formula C8H13NO3 and a molecular weight of 171.20 g/mol. Its IUPAC name is (1R,2S,8R)-2-hydroxy-1-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1R,2S,8R)-2-hydroxy-1-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 101448339 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | (1R,2S,8R)-2-hydroxy-1-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1[C@@H](O)[C@@H](CO)[C@H]2CCCN12 |
| InChI | InChI=1S/C8H13NO3/c10-4-5-6-2-1-3-9(6)8(12)7(5)11/h5-7,10-11H,1-4H2/t5-,6+,7-/m0/s1 |
| InChIKey | FEPDNVHVHLRNNB-XVMARJQXSA-N |
| XLogP | -1.04 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |