C17H33NO3Si — CID 10806141
(2S,7R,8R)-8-hydroxy-7-methyl-2-tri(propan-2-yl)silyloxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 10806141) has the molecular formula C17H33NO3Si and a molecular weight of 327.54 g/mol. Its IUPAC name is (2S,7R,8R)-8-hydroxy-7-methyl-2-tri(propan-2-yl)silyloxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (2S,7R,8R)-8-hydroxy-7-methyl-2-tri(propan-2-yl)silyloxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 10806141 |
| Molecular Formula | C17H33NO3Si |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (2S,7R,8R)-8-hydroxy-7-methyl-2-tri(propan-2-yl)silyloxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC(C)[Si](O[C@H]1C[C@@]2(O)[C@H](C)CCN2C1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H33NO3Si/c1-11(2)22(12(3)4,13(5)6)21-15-10-17(20)14(7)8-9-18(17)16(15)19/h11-15,20H,8-10H2,1-7H3/t14-,15+,17-/m1/s1 |
| InChIKey | DTSWNQVKDCTQAJ-HLLBOEOZSA-N |
| XLogP | 3.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|