C19H39NO4Si2 — CID 10501255
(1R,2R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 10501255) has the molecular formula C19H39NO4Si2 and a molecular weight of 401.70 g/mol. Its IUPAC name is (1R,2R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1R,2R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 10501255 |
| Molecular Formula | C19H39NO4Si2 |
| Molecular Weight | 401.70 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (1R,2R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2CCC[C@@]12O |
| InChI | InChI=1S/C19H39NO4Si2/c1-17(2,3)25(7,8)23-14-15(24-26(9,10)18(4,5)6)19(22)12-11-13-20(19)16(14)21/h14-15,22H,11-13H2,1-10H3/t14-,15-,19-/m1/s1 |
| InChIKey | QSGFIMKCAORXHZ-SPYBWZPUSA-N |
| XLogP | 4.09 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|