C13H25NO3Si — CID 10826012
(1S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 10826012) has the molecular formula C13H25NO3Si and a molecular weight of 271.43 g/mol. Its IUPAC name is (1S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 10826012 |
| Molecular Formula | C13H25NO3Si |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)N2CCC[C@]12O |
| InChI | InChI=1S/C13H25NO3Si/c1-12(2,3)18(4,5)17-10-9-11(15)14-8-6-7-13(10,14)16/h10,16H,6-9H2,1-5H3/t10-,13-/m0/s1 |
| InChIKey | VASKVXVMCHACJD-GWCFXTLKSA-N |
| XLogP | 2.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|