C15H29NO3Si — CID 11022946
(1R,8R)-1-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11022946) has the molecular formula C15H29NO3Si and a molecular weight of 299.49 g/mol. Its IUPAC name is (1R,8R)-1-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1R,8R)-1-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11022946 |
| Molecular Formula | C15H29NO3Si |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (1R,8R)-1-[(1S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H]1CC(=O)N2CCC[C@H]12 |
| InChI | InChI=1S/C15H29NO3Si/c1-15(2,3)20(4,5)19-10-13(17)11-9-14(18)16-8-6-7-12(11)16/h11-13,17H,6-10H2,1-5H3/t11-,12-,13-/m1/s1 |
| InChIKey | CHWUFBFVTSKORT-JHJVBQTASA-N |
| XLogP | 2.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|