C15H27NO4Si — CID 11758806
2-[(1S,6R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]acetic acid (PubChem CID 11758806) has the molecular formula C15H27NO4Si and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-[(1S,6R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]acetic acid.
| Compound Name | 2-[(1S,6R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]acetic acid |
|---|---|
| PubChem CID | 11758806 |
| Molecular Formula | C15H27NO4Si |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-[(1S,6R,8S)-6-[tert-butyl(dimethyl)silyl]oxy-3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-1-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2[C@H](CC(=O)O)CC(=O)N2C1 |
| InChI | InChI=1S/C15H27NO4Si/c1-15(2,3)21(4,5)20-11-8-12-10(7-14(18)19)6-13(17)16(12)9-11/h10-12H,6-9H2,1-5H3,(H,18,19)/t10-,11+,12-/m0/s1 |
| InChIKey | FNUQGCIDEWSTLM-TUAOUCFPSA-N |
| XLogP | 2.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|