C13H25NO2Si — CID 15705512
(7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 15705512) has the molecular formula C13H25NO2Si and a molecular weight of 255.43 g/mol. Its IUPAC name is (7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 15705512 |
| Molecular Formula | C13H25NO2Si |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C13H25NO2Si/c1-13(2,3)17(4,5)16-11-8-9-14-10(11)6-7-12(14)15/h10-11H,6-9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | ZNMGFQLMCUFGSQ-QWRGUYRKSA-N |
| XLogP | 2.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|