C19H39NO3Si2 — CID 10548156
(1S,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 10548156) has the molecular formula C19H39NO3Si2 and a molecular weight of 385.70 g/mol. Its IUPAC name is (1S,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 10548156 |
| Molecular Formula | C19H39NO3Si2 |
| Molecular Weight | 385.70 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | (1S,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C19H39NO3Si2/c1-18(2,3)24(7,8)22-15-14-12-11-13-20(14)17(21)16(15)23-25(9,10)19(4,5)6/h14-16H,11-13H2,1-10H3/t14-,15-,16+/m0/s1 |
| InChIKey | FRRJYABXPKRTAK-HRCADAONSA-N |
| XLogP | 4.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|