C17H33NO2Si — CID 101192231
(2S,7R,8S)-7-methyl-2-tri(propan-2-yl)silyloxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 101192231) has the molecular formula C17H33NO2Si and a molecular weight of 311.54 g/mol. Its IUPAC name is (2S,7R,8S)-7-methyl-2-tri(propan-2-yl)silyloxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (2S,7R,8S)-7-methyl-2-tri(propan-2-yl)silyloxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 101192231 |
| Molecular Formula | C17H33NO2Si |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | (2S,7R,8S)-7-methyl-2-tri(propan-2-yl)silyloxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CC(C)[Si](O[C@H]1C[C@H]2[C@H](C)CCN2C1=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H33NO2Si/c1-11(2)21(12(3)4,13(5)6)20-16-10-15-14(7)8-9-18(15)17(16)19/h11-16H,8-10H2,1-7H3/t14-,15+,16+/m1/s1 |
| InChIKey | NERAOIAXHZINHU-PMPSAXMXSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|