C20H39F2NO3Si2 — CID 71505256
(1S,2R,6R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 71505256) has the molecular formula C20H39F2NO3Si2 and a molecular weight of 435.70 g/mol. Its IUPAC name is (1S,2R,6R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1S,2R,6R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 71505256 |
| Molecular Formula | C20H39F2NO3Si2 |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | (1S,2R,6R,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@@H]1CN2C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C1(F)F |
| InChI | InChI=1S/C20H39F2NO3Si2/c1-13-12-23-16(20(13,21)22)14(25-27(8,9)18(2,3)4)15(17(23)24)26-28(10,11)19(5,6)7/h13-16H,12H2,1-11H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | PPGFWLQZNVUCJC-KLHDSHLOSA-N |
| XLogP | 5.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|