C14H25F2NO3Si — CID 71505446
(1S,2R,6R,8R)-1-[tert-butyl(dimethyl)silyl]oxy-7,7-difluoro-2-hydroxy-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 71505446) has the molecular formula C14H25F2NO3Si and a molecular weight of 321.44 g/mol. Its IUPAC name is (1S,2R,6R,8R)-1-[tert-butyl(dimethyl)silyl]oxy-7,7-difluoro-2-hydroxy-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (1S,2R,6R,8R)-1-[tert-butyl(dimethyl)silyl]oxy-7,7-difluoro-2-hydroxy-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 71505446 |
| Molecular Formula | C14H25F2NO3Si |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (1S,2R,6R,8R)-1-[tert-butyl(dimethyl)silyl]oxy-7,7-difluoro-2-hydroxy-6-methyl-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[C@@H]1CN2C(=O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C1(F)F |
| InChI | InChI=1S/C14H25F2NO3Si/c1-8-7-17-11(14(8,15)16)10(9(18)12(17)19)20-21(5,6)13(2,3)4/h8-11,18H,7H2,1-6H3/t8-,9-,10-,11-/m1/s1 |
| InChIKey | JXOHSRVZQFQFDO-GWOFURMSSA-N |
| XLogP | 2.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|