C20H39F2NO4Si2 — CID 71505795
(1R,2R,6S,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-8-hydroxy-6-methyl-1,2,5,6-tetrahydropyrrolizin-3-one (PubChem CID 71505795) has the molecular formula C20H39F2NO4Si2 and a molecular weight of 451.70 g/mol. Its IUPAC name is (1R,2R,6S,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-8-hydroxy-6-methyl-1,2,5,6-tetrahydropyrrolizin-3-one.
| Compound Name | (1R,2R,6S,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-8-hydroxy-6-methyl-1,2,5,6-tetrahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 71505795 |
| Molecular Formula | C20H39F2NO4Si2 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (1R,2R,6S,8R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-7,7-difluoro-8-hydroxy-6-methyl-1,2,5,6-tetrahydropyrrolizin-3-one |
| SMILES | C[C@H]1CN2C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]2(O)C1(F)F |
| InChI | InChI=1S/C20H39F2NO4Si2/c1-13-12-23-16(24)14(26-28(8,9)17(2,3)4)15(20(23,25)19(13,21)22)27-29(10,11)18(5,6)7/h13-15,25H,12H2,1-11H3/t13-,14+,15+,20+/m0/s1 |
| InChIKey | SNXBQWFFQQVKJU-LYKCQVCGSA-N |
| XLogP | 4.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|