C19H37NO3Si — CID 135070687
5-ethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 135070687) has the molecular formula C19H37NO3Si and a molecular weight of 355.60 g/mol. Its IUPAC name is 5-ethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | 5-ethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 135070687 |
| Molecular Formula | C19H37NO3Si |
| Molecular Weight | 355.60 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 5-ethoxy-7-[tri(propan-2-yl)silyloxymethyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CCOC1CC(CO[Si](C(C)C)(C(C)C)C(C)C)C2CCC(=O)N12 |
| InChI | InChI=1S/C19H37NO3Si/c1-8-22-19-11-16(17-9-10-18(21)20(17)19)12-23-24(13(2)3,14(4)5)15(6)7/h13-17,19H,8-12H2,1-7H3 |
| InChIKey | NYJRSMPYZTZXNH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|