C16H31NO3Si — CID 10946939
(5S,7S,8S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 10946939) has the molecular formula C16H31NO3Si and a molecular weight of 313.51 g/mol. Its IUPAC name is (5S,7S,8S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (5S,7S,8S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 10946939 |
| Molecular Formula | C16H31NO3Si |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | (5S,7S,8S)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethoxy-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | CCO[C@H]1C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]2CCC(=O)N12 |
| InChI | InChI=1S/C16H31NO3Si/c1-7-19-15-10-12(13-8-9-14(18)17(13)15)11-20-21(5,6)16(2,3)4/h12-13,15H,7-11H2,1-6H3/t12-,13+,15+/m1/s1 |
| InChIKey | KRFLXVCTYMXZOC-IPYPFGDCSA-N |
| XLogP | 3.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|