C13H23NO2Si — CID 10777287
(4R,7S,10S)-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one (PubChem CID 10777287) has the molecular formula C13H23NO2Si and a molecular weight of 253.42 g/mol. Its IUPAC name is (4R,7S,10S)-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one.
| Compound Name | (4R,7S,10S)-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one |
|---|---|
| PubChem CID | 10777287 |
| Molecular Formula | C13H23NO2Si |
| Molecular Weight | 253.42 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4R,7S,10S)-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one |
| SMILES | CC(C)[Si]1(C(C)C)O[C@@H]2CCN3C(=O)C[C@H]1[C@H]23 |
| InChI | InChI=1S/C13H23NO2Si/c1-8(2)17(9(3)4)11-7-12(15)14-6-5-10(16-17)13(11)14/h8-11,13H,5-7H2,1-4H3/t10-,11+,13+/m1/s1 |
| InChIKey | ZAGPGVMDLZIMFL-MDZLAQPJSA-N |
| XLogP | 2.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|