C13H23NO3Si — CID 11043802
(4R,7R,8S,10R)-8-hydroxy-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one (PubChem CID 11043802) has the molecular formula C13H23NO3Si and a molecular weight of 269.42 g/mol. Its IUPAC name is (4R,7R,8S,10R)-8-hydroxy-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one.
| Compound Name | (4R,7R,8S,10R)-8-hydroxy-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one |
|---|---|
| PubChem CID | 11043802 |
| Molecular Formula | C13H23NO3Si |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (4R,7R,8S,10R)-8-hydroxy-6,6-di(propan-2-yl)-5-oxa-1-aza-6-silatricyclo[5.2.1.04,10]decan-9-one |
| SMILES | CC(C)[Si]1(C(C)C)O[C@@H]2CCN3C(=O)[C@H](O)[C@H]1[C@@H]23 |
| InChI | InChI=1S/C13H23NO3Si/c1-7(2)18(8(3)4)12-10-9(17-18)5-6-14(10)13(16)11(12)15/h7-12,15H,5-6H2,1-4H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | GCCMWCWRACUDFS-DDHJBXDOSA-N |
| XLogP | 1.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|