C20H41NO4Si2 — CID 102367800
(1R,2R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-hydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 102367800) has the molecular formula C20H41NO4Si2 and a molecular weight of 415.72 g/mol. Its IUPAC name is (1R,2R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-hydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (1R,2R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-hydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 102367800 |
| Molecular Formula | C20H41NO4Si2 |
| Molecular Weight | 415.72 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (1R,2R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-hydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2CCCC[C@@]12O |
| InChI | InChI=1S/C20H41NO4Si2/c1-18(2,3)26(7,8)24-15-16(25-27(9,10)19(4,5)6)20(23)13-11-12-14-21(20)17(15)22/h15-16,23H,11-14H2,1-10H3/t15-,16-,20-/m1/s1 |
| InChIKey | ZVQBAJUQGAFFBJ-JXXFODFXSA-N |
| XLogP | 4.48 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|