C26H55NO5Si3 — CID 10951707
(1S,6R,7S,8R,8aS)-1,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 10951707) has the molecular formula C26H55NO5Si3 and a molecular weight of 545.99 g/mol. Its IUPAC name is (1S,6R,7S,8R,8aS)-1,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1S,6R,7S,8R,8aS)-1,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10951707 |
| Molecular Formula | C26H55NO5Si3 |
| Molecular Weight | 545.99 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | (1S,6R,7S,8R,8aS)-1,6,7-tris[[tert-butyl(dimethyl)silyl]oxy]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCN2C(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H55NO5Si3/c1-24(2,3)33(10,11)30-18-16-17-27-19(18)20(28)21(31-34(12,13)25(4,5)6)22(23(27)29)32-35(14,15)26(7,8)9/h18-22,28H,16-17H2,1-15H3/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | LGSWUPKOVZTBSI-AHJNKEMKSA-N |
| XLogP | 6.13 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.99 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|