C14H27NO4Si — CID 11312670
(1R,6R,7S,8aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11312670) has the molecular formula C14H27NO4Si and a molecular weight of 301.46 g/mol. Its IUPAC name is (1R,6R,7S,8aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (1R,6R,7S,8aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11312670 |
| Molecular Formula | C14H27NO4Si |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (1R,6R,7S,8aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(=O)N2C[C@@H](O)[C@@H](O)C[C@H]12 |
| InChI | InChI=1S/C14H27NO4Si/c1-14(2,3)20(4,5)19-12-7-13(18)15-8-11(17)10(16)6-9(12)15/h9-12,16-17H,6-8H2,1-5H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | WFMRQUAJQRABHD-WRWGMCAJSA-N |
| XLogP | 1.10 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|