C20H41NO5Si2 — CID 10836456
(1R,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8a-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 10836456) has the molecular formula C20H41NO5Si2 and a molecular weight of 431.72 g/mol. Its IUPAC name is (1R,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8a-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (1R,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8a-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 10836456 |
| Molecular Formula | C20H41NO5Si2 |
| Molecular Weight | 431.72 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | (1R,2R,8S)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8a-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N2CCC[C@H](O)C12O |
| InChI | InChI=1S/C20H41NO5Si2/c1-18(2,3)27(7,8)25-15-16(26-28(9,10)19(4,5)6)20(24)14(22)12-11-13-21(20)17(15)23/h14-16,22,24H,11-13H2,1-10H3/t14-,15+,16+,20?/m0/s1 |
| InChIKey | SVOYBWZBPBAWSZ-VZSIPSJESA-N |
| XLogP | 3.45 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.72 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|