C8H13NO4 — CID 59904011
(1R,8S,8aR)-1,2,8-trihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 59904011) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (1R,8S,8aR)-1,2,8-trihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (1R,8S,8aR)-1,2,8-trihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 59904011 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (1R,8S,8aR)-1,2,8-trihydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | O=C1C(O)[C@H](O)[C@H]2[C@@H](O)CCCN12 |
| InChI | InChI=1S/C8H13NO4/c10-4-2-1-3-9-5(4)6(11)7(12)8(9)13/h4-7,10-12H,1-3H2/t4-,5+,6+,7?/m0/s1 |
| InChIKey | IOMYJLKKCKVWKZ-CUWOBHIPSA-N |
| XLogP | -1.93 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |