C15H29NO4Si — CID 101394080
(6R,7S,8aR)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 101394080) has the molecular formula C15H29NO4Si and a molecular weight of 315.49 g/mol. Its IUPAC name is (6R,7S,8aR)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (6R,7S,8aR)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 101394080 |
| Molecular Formula | C15H29NO4Si |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (6R,7S,8aR)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,7-dihydroxy-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12CCC(=O)N1C[C@@H](O)[C@@H](O)C2 |
| InChI | InChI=1S/C15H29NO4Si/c1-14(2,3)21(4,5)20-10-15-7-6-13(19)16(15)9-12(18)11(17)8-15/h11-12,17-18H,6-10H2,1-5H3/t11-,12+,15+/m0/s1 |
| InChIKey | ZBWVSYOMMDNJLM-YWPYICTPSA-N |
| XLogP | 1.49 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|