C9H15NO4 — CID 11030858
(6R,7S,8R,8aR)-6,7,8-trihydroxy-8a-methyl-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 11030858) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is (6R,7S,8R,8aR)-6,7,8-trihydroxy-8a-methyl-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (6R,7S,8R,8aR)-6,7,8-trihydroxy-8a-methyl-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 11030858 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | (6R,7S,8R,8aR)-6,7,8-trihydroxy-8a-methyl-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | C[C@]12CCC(=O)N1C[C@@H](O)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C9H15NO4/c1-9-3-2-6(12)10(9)4-5(11)7(13)8(9)14/h5,7-8,11,13-14H,2-4H2,1H3/t5-,7+,8+,9-/m1/s1 |
| InChIKey | VWCZUZIXRQAXPL-RSWFSCQZSA-N |
| XLogP | -1.54 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |