C17H20O4 — CID 101449741
dimethyl (5S,7S)-5-phenylspiro[2.4]heptane-5,7-dicarboxylate (PubChem CID 101449741) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is dimethyl (5S,7S)-5-phenylspiro[2.4]heptane-5,7-dicarboxylate.
| Compound Name | dimethyl (5S,7S)-5-phenylspiro[2.4]heptane-5,7-dicarboxylate |
|---|---|
| PubChem CID | 101449741 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | dimethyl (5S,7S)-5-phenylspiro[2.4]heptane-5,7-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@](C(=O)OC)(c2ccccc2)CC12CC2 |
| InChI | InChI=1S/C17H20O4/c1-20-14(18)13-10-17(15(19)21-2,11-16(13)8-9-16)12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3/t13-,17+/m1/s1 |
| InChIKey | QBPKFGLCRKDIEH-DYVFJYSZSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |