About methyl 2-phenyldodecanoate
methyl 2-phenyldodecanoate (PubChem CID 102031423) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is methyl 2-phenyldodecanoate.
Molecular Properties
| Compound Name | methyl 2-phenyldodecanoate |
| PubChem CID | 102031423 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | methyl 2-phenyldodecanoate |
| SMILES | CCCCCCCCCCC(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C19H30O2/c1-3-4-5-6-7-8-9-13-16-18(19(20)21-2)17-14-11-10-12-15-17/h10-12,14-15,18H,3-9,13,16H2,1-2H3 |
| InChIKey | XGDYIFMUMMUAEP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-phenyldodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenyldodecanoate?
The IUPAC name of methyl 2-phenyldodecanoate (CID 102031423) is methyl 2-phenyldodecanoate.
What is the SMILES notation for methyl 2-phenyldodecanoate?
The canonical SMILES for methyl 2-phenyldodecanoate is CCCCCCCCCCC(C(=O)OC)c1ccccc1.
What is the InChIKey of methyl 2-phenyldodecanoate?
The InChIKey is XGDYIFMUMMUAEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-3-4-5-6-7-8-9-13-16-18(19(20)21-2)17-14-11-10-12-15-17/h10-12,14-15,18H,3-9,13,16H2,1-2H3.
What are the key properties of methyl 2-phenyldodecanoate?
methyl 2-phenyldodecanoate has a molecular weight of 290.45 g/mol, XLogP of 5.47, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenyldodecanoate is sourced from PubChem (CID 102031423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).