C22H22N2O6 — CID 101450163
2-[[(7R,9S)-7-(hydroxymethyl)-5-methoxy-4-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinolin-9-yl]methyl]isoindole-1,3-dione (PubChem CID 101450163) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[[(7R,9S)-7-(hydroxymethyl)-5-methoxy-4-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinolin-9-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(7R,9S)-7-(hydroxymethyl)-5-methoxy-4-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinolin-9-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101450163 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[[(7R,9S)-7-(hydroxymethyl)-5-methoxy-4-methyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinolin-9-yl]methyl]isoindole-1,3-dione |
| SMILES | COc1c(C)c2c(c3c1C[C@H](CO)N[C@@H]3CN1C(=O)c3ccccc3C1=O)OCO2 |
| InChI | InChI=1S/C22H22N2O6/c1-11-18(28-2)15-7-12(9-25)23-16(17(15)20-19(11)29-10-30-20)8-24-21(26)13-5-3-4-6-14(13)22(24)27/h3-6,12,16,23,25H,7-10H2,1-2H3/t12-,16-/m1/s1 |
| InChIKey | FUSICDMBLPRYQT-MLGOLLRUSA-N |
| XLogP | 1.58 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|