C25H25N3O7 — CID 71763443
(6S,11aS)-6-[(1,3-dioxoisoindol-2-yl)methyl]-10-hydroxy-7,8-dimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione (PubChem CID 71763443) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is (6S,11aS)-6-[(1,3-dioxoisoindol-2-yl)methyl]-10-hydroxy-7,8-dimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione.
| Compound Name | (6S,11aS)-6-[(1,3-dioxoisoindol-2-yl)methyl]-10-hydroxy-7,8-dimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione |
|---|---|
| PubChem CID | 71763443 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (6S,11aS)-6-[(1,3-dioxoisoindol-2-yl)methyl]-10-hydroxy-7,8-dimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione |
| SMILES | COc1c(C)c(O)c2c(c1OC)[C@@H](CN1C(=O)c3ccccc3C1=O)N1C(=O)CN(C)C(=O)[C@@H]1C2 |
| InChI | InChI=1S/C25H25N3O7/c1-12-20(30)15-9-16-25(33)26(2)11-18(29)28(16)17(19(15)22(35-4)21(12)34-3)10-27-23(31)13-7-5-6-8-14(13)24(27)32/h5-8,16-17,30H,9-11H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | KRDZQAAQNUTXAO-DLBZAZTESA-N |
| XLogP | 1.28 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|