C18H25N3O5 — CID 71763203
(6R,11aS)-6-(aminomethyl)-7,8,10-trimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione (PubChem CID 71763203) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is (6R,11aS)-6-(aminomethyl)-7,8,10-trimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione.
| Compound Name | (6R,11aS)-6-(aminomethyl)-7,8,10-trimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione |
|---|---|
| PubChem CID | 71763203 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (6R,11aS)-6-(aminomethyl)-7,8,10-trimethoxy-2,9-dimethyl-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinoline-1,4-dione |
| SMILES | COc1c(C)c(OC)c(OC)c2c1C[C@H]1C(=O)N(C)CC(=O)N1[C@H]2CN |
| InChI | InChI=1S/C18H25N3O5/c1-9-15(24-3)10-6-11-18(23)20(2)8-13(22)21(11)12(7-19)14(10)17(26-5)16(9)25-4/h11-12H,6-8,19H2,1-5H3/t11-,12-/m0/s1 |
| InChIKey | NYAFFBKXERVGPJ-RYUDHWBXSA-N |
| XLogP | 0.25 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |