C28H33BrN2O7 — CID 91297257
(1R,10S,13S)-16-bromo-10-ethyl-19-hydroxy-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15,17,19-hexaene-3,12-dione (PubChem CID 91297257) has the molecular formula C28H33BrN2O7 and a molecular weight of 589.48 g/mol. Its IUPAC name is (1R,10S,13S)-16-bromo-10-ethyl-19-hydroxy-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15,17,19-hexaene-3,12-dione.
| Compound Name | (1R,10S,13S)-16-bromo-10-ethyl-19-hydroxy-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15,17,19-hexaene-3,12-dione |
|---|---|
| PubChem CID | 91297257 |
| Molecular Formula | C28H33BrN2O7 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (1R,10S,13S)-16-bromo-10-ethyl-19-hydroxy-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15,17,19-hexaene-3,12-dione |
| SMILES | CC[C@H]1c2c(OC)c(OC)c(C)c(OC)c2C(=O)C2[C@H]3c4c(O)c(OC)c(C)c(Br)c4C[C@@H](C(=O)N21)N3C |
| InChI | InChI=1S/C28H33BrN2O7/c1-9-14-17-18(24(35-5)12(3)26(37-7)27(17)38-8)22(32)21-20-16-13(10-15(30(20)4)28(34)31(14)21)19(29)11(2)25(36-6)23(16)33/h14-15,20-21,33H,9-10H2,1-8H3/t14-,15-,20+,21?/m0/s1 |
| InChIKey | ANYHLEHBOFUENN-MDOOXIRGSA-N |
| XLogP | 4.26 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|