C27H32N2O8 — CID 59878411
(10R)-19-hydroxy-10-(hydroxymethyl)-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaene-3,12-dione (PubChem CID 59878411) has the molecular formula C27H32N2O8 and a molecular weight of 512.56 g/mol. Its IUPAC name is (10R)-19-hydroxy-10-(hydroxymethyl)-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaene-3,12-dione.
| Compound Name | (10R)-19-hydroxy-10-(hydroxymethyl)-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaene-3,12-dione |
|---|---|
| PubChem CID | 59878411 |
| Molecular Formula | C27H32N2O8 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (10R)-19-hydroxy-10-(hydroxymethyl)-5,7,8,18-tetramethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaene-3,12-dione |
| SMILES | COc1c(C)cc2c(c1O)C1C3C(=O)c4c(OC)c(C)c(OC)c(OC)c4[C@H](CO)N3C(=O)C(C2)N1C |
| InChI | InChI=1S/C27H32N2O8/c1-11-8-13-9-14-27(33)29-15(10-30)17-18(24(35-5)12(2)25(36-6)26(17)37-7)21(31)20(29)19(28(14)3)16(13)22(32)23(11)34-4/h8,14-15,19-20,30,32H,9-10H2,1-7H3/t14?,15-,19?,20?/m0/s1 |
| InChIKey | NCPKDBQTQHLABB-IEEUDWRLSA-N |
| XLogP | 2.08 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|