C32H42N2O6 — CID 123752774
9-(hydroxymethyl)-2-methoxy-3,12-dimethyl-6-(methylamino)-10,11,13-tris(prop-2-enoxy)-5,6,7,9,14,14a-hexahydroisoquinolino[3,2-a][2]benzazepin-1-ol (PubChem CID 123752774) has the molecular formula C32H42N2O6 and a molecular weight of 550.70 g/mol. Its IUPAC name is 9-(hydroxymethyl)-2-methoxy-3,12-dimethyl-6-(methylamino)-10,11,13-tris(prop-2-enoxy)-5,6,7,9,14,14a-hexahydroisoquinolino[3,2-a][2]benzazepin-1-ol.
| Compound Name | 9-(hydroxymethyl)-2-methoxy-3,12-dimethyl-6-(methylamino)-10,11,13-tris(prop-2-enoxy)-5,6,7,9,14,14a-hexahydroisoquinolino[3,2-a][2]benzazepin-1-ol |
|---|---|
| PubChem CID | 123752774 |
| Molecular Formula | C32H42N2O6 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | 9-(hydroxymethyl)-2-methoxy-3,12-dimethyl-6-(methylamino)-10,11,13-tris(prop-2-enoxy)-5,6,7,9,14,14a-hexahydroisoquinolino[3,2-a][2]benzazepin-1-ol |
| SMILES | C=CCOc1c(C)c(OCC=C)c(OCC=C)c2c1CC1c3c(cc(C)c(OC)c3O)CC(NC)CN1C2CO |
| InChI | InChI=1S/C32H42N2O6/c1-8-11-38-30-20(5)31(39-12-9-2)32(40-13-10-3)27-23(30)16-24-26-21(14-19(4)29(37-7)28(26)36)15-22(33-6)17-34(24)25(27)18-35/h8-10,14,22,24-25,33,35-36H,1-3,11-13,15-18H2,4-7H3 |
| InChIKey | PSJSYARJWOVYLO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|