C26H32N2O8 — CID 59878408
(10R,13S)-3,5,19-trihydroxy-10-(hydroxymethyl)-7,8,18-trimethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-12-one (PubChem CID 59878408) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is (10R,13S)-3,5,19-trihydroxy-10-(hydroxymethyl)-7,8,18-trimethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-12-one.
| Compound Name | (10R,13S)-3,5,19-trihydroxy-10-(hydroxymethyl)-7,8,18-trimethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-12-one |
|---|---|
| PubChem CID | 59878408 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | (10R,13S)-3,5,19-trihydroxy-10-(hydroxymethyl)-7,8,18-trimethoxy-6,17,21-trimethyl-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-4(9),5,7,15(20),16,18-hexaen-12-one |
| SMILES | COc1c(C)cc2c(c1O)C1C3C(O)c4c(O)c(C)c(OC)c(OC)c4[C@H](CO)N3C(=O)[C@H](C2)N1C |
| InChI | InChI=1S/C26H32N2O8/c1-10-7-12-8-13-26(33)28-14(9-29)16-17(20(30)11(2)24(35-5)25(16)36-6)21(31)19(28)18(27(13)3)15(12)22(32)23(10)34-4/h7,13-14,18-19,21,29-32H,8-9H2,1-6H3/t13-,14-,18?,19?,21?/m0/s1 |
| InChIKey | WNFXWNAKYSMIND-MJVCOJARSA-N |
| XLogP | 1.63 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|