C28H36N2O6 — CID 142096650
(2R,14R)-14-(dimethylamino)-2-(hydroxymethyl)-17-methoxy-9,18-dimethyl-10-prop-2-enoxy-5,7-dioxa-1-azapentacyclo[11.9.0.03,11.04,8.015,20]docosa-3,8,10,15(20),16,18-hexaen-16-ol (PubChem CID 142096650) has the molecular formula C28H36N2O6 and a molecular weight of 496.60 g/mol. Its IUPAC name is (2R,14R)-14-(dimethylamino)-2-(hydroxymethyl)-17-methoxy-9,18-dimethyl-10-prop-2-enoxy-5,7-dioxa-1-azapentacyclo[11.9.0.03,11.04,8.015,20]docosa-3,8,10,15(20),16,18-hexaen-16-ol.
| Compound Name | (2R,14R)-14-(dimethylamino)-2-(hydroxymethyl)-17-methoxy-9,18-dimethyl-10-prop-2-enoxy-5,7-dioxa-1-azapentacyclo[11.9.0.03,11.04,8.015,20]docosa-3,8,10,15(20),16,18-hexaen-16-ol |
|---|---|
| PubChem CID | 142096650 |
| Molecular Formula | C28H36N2O6 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (2R,14R)-14-(dimethylamino)-2-(hydroxymethyl)-17-methoxy-9,18-dimethyl-10-prop-2-enoxy-5,7-dioxa-1-azapentacyclo[11.9.0.03,11.04,8.015,20]docosa-3,8,10,15(20),16,18-hexaen-16-ol |
| SMILES | C=CCOc1c(C)c2c(c3c1CC1[C@H](N(C)C)c4c(cc(C)c(OC)c4O)CCN1[C@H]3CO)OCO2 |
| InChI | InChI=1S/C28H36N2O6/c1-7-10-34-26-16(3)27-28(36-14-35-27)22-18(26)12-19-23(29(4)5)21-17(8-9-30(19)20(22)13-31)11-15(2)25(33-6)24(21)32/h7,11,19-20,23,31-32H,1,8-10,12-14H2,2-6H3/t19?,20-,23-/m0/s1 |
| InChIKey | ATKNEBCLTZGRRK-MQBGSOHWSA-N |
| XLogP | 3.43 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|