C26H30N3O6- — CID 142096710
[(1R,16S)-13-(aminomethyl)-22-hydroxy-21-methoxy-6,20-dimethyl-8,10-dioxa-14-aza-24-azanidahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate (PubChem CID 142096710) has the molecular formula C26H30N3O6- and a molecular weight of 480.54 g/mol. Its IUPAC name is [(1R,16S)-13-(aminomethyl)-22-hydroxy-21-methoxy-6,20-dimethyl-8,10-dioxa-14-aza-24-azanidahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate.
| Compound Name | [(1R,16S)-13-(aminomethyl)-22-hydroxy-21-methoxy-6,20-dimethyl-8,10-dioxa-14-aza-24-azanidahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
|---|---|
| PubChem CID | 142096710 |
| Molecular Formula | C26H30N3O6- |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | [(1R,16S)-13-(aminomethyl)-22-hydroxy-21-methoxy-6,20-dimethyl-8,10-dioxa-14-aza-24-azanidahexacyclo[14.7.1.02,14.04,12.07,11.018,23]tetracosa-4,6,11,18(23),19,21-hexaen-5-yl] acetate |
| SMILES | COc1c(C)cc2c(c1O)[C@H]1[N-][C@@H](C2)CN2C(CN)c3c(c(OC(C)=O)c(C)c4c3OCO4)CC12 |
| InChI | InChI=1S/C26H30N3O6/c1-11-5-14-6-15-9-29-17(21(28-15)19(14)22(31)23(11)32-4)7-16-20(18(29)8-27)26-25(33-10-34-26)12(2)24(16)35-13(3)30/h5,15,17-18,21,31H,6-10,27H2,1-4H3/q-1/t15-,17?,18?,21-/m0/s1 |
| InChIKey | IZPWPXUPYWKSNQ-NSUOALMASA-N |
| XLogP | 2.95 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|