C15H18N2O5 — CID 14588337
3,6-dihydroxy-4-methoxy-5,11,13-trimethyl-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8,10-dione (PubChem CID 14588337) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3,6-dihydroxy-4-methoxy-5,11,13-trimethyl-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8,10-dione.
| Compound Name | 3,6-dihydroxy-4-methoxy-5,11,13-trimethyl-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8,10-dione |
|---|---|
| PubChem CID | 14588337 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3,6-dihydroxy-4-methoxy-5,11,13-trimethyl-11,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8,10-dione |
| SMILES | COc1c(C)c(O)c2c(c1O)C1CN(C)C(=O)C(C2=O)N1C |
| InChI | InChI=1S/C15H18N2O5/c1-6-11(18)9-8(13(20)14(6)22-4)7-5-16(2)15(21)10(12(9)19)17(7)3/h7,10,18,20H,5H2,1-4H3 |
| InChIKey | AJWAAZQXEBMASM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|