C17H20N2O6 — CID 71762985
(1S,7R,13R)-12,13-dimethoxy-5,11-dimethyl-14-oxa-2,5-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9(16),11-diene-3,6,10-trione (PubChem CID 71762985) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is (1S,7R,13R)-12,13-dimethoxy-5,11-dimethyl-14-oxa-2,5-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9(16),11-diene-3,6,10-trione.
| Compound Name | (1S,7R,13R)-12,13-dimethoxy-5,11-dimethyl-14-oxa-2,5-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9(16),11-diene-3,6,10-trione |
|---|---|
| PubChem CID | 71762985 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (1S,7R,13R)-12,13-dimethoxy-5,11-dimethyl-14-oxa-2,5-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-9(16),11-diene-3,6,10-trione |
| SMILES | COC1=C(C)C(=O)C2=C3[C@@H](CO[C@@]13OC)N1C(=O)CN(C)C(=O)[C@H]1C2 |
| InChI | InChI=1S/C17H20N2O6/c1-8-14(21)9-5-10-16(22)18(2)6-12(20)19(10)11-7-25-17(24-4,13(9)11)15(8)23-3/h10-11H,5-7H2,1-4H3/t10-,11-,17-/m1/s1 |
| InChIKey | WBLQEHHVDXXALN-CZIZLABSSA-N |
| XLogP | -0.40 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |