C22H19N3O4 — CID 172991736
(2S,8R)-2-(1,3-benzodioxol-4-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 172991736) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is (2S,8R)-2-(1,3-benzodioxol-4-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2S,8R)-2-(1,3-benzodioxol-4-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 172991736 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (2S,8R)-2-(1,3-benzodioxol-4-yl)-6-methyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CN1CC(=O)N2[C@@H](c3cccc4c3OCO4)c3[nH]c4ccccc4c3C[C@@H]2C1=O |
| InChI | InChI=1S/C22H19N3O4/c1-24-10-18(26)25-16(22(24)27)9-14-12-5-2-3-7-15(12)23-19(14)20(25)13-6-4-8-17-21(13)29-11-28-17/h2-8,16,20,23H,9-11H2,1H3/t16-,20+/m1/s1 |
| InChIKey | XZHITTZRVSAULD-UZLBHIALSA-N |
| XLogP | 2.21 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|