C29H34N2O8 — CID 56834865
(1S,10R,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-12-oxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaene-10-carbaldehyde (PubChem CID 56834865) has the molecular formula C29H34N2O8 and a molecular weight of 538.60 g/mol. Its IUPAC name is (1S,10R,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-12-oxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaene-10-carbaldehyde.
| Compound Name | (1S,10R,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-12-oxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaene-10-carbaldehyde |
|---|---|
| PubChem CID | 56834865 |
| Molecular Formula | C29H34N2O8 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | (1S,10R,13S)-5,7,8,16,18,19-hexamethoxy-6,17,21-trimethyl-12-oxo-11,21-diazapentacyclo[11.7.1.02,11.04,9.015,20]henicosa-2,4(9),5,7,15(20),16,18-heptaene-10-carbaldehyde |
| SMILES | COc1c(C)c(OC)c(OC)c2c1C=C1[C@@H]3c4c(c(OC)c(C)c(OC)c4OC)C[C@@H](C(=O)N1[C@H]2C=O)N3C |
| InChI | InChI=1S/C29H34N2O8/c1-13-23(34-4)15-10-17-22-21-16(24(35-5)14(2)26(37-7)28(21)39-9)11-18(30(22)3)29(33)31(17)19(12-32)20(15)27(38-8)25(13)36-6/h10,12,18-19,22H,11H2,1-9H3/t18-,19-,22+/m0/s1 |
| InChIKey | IKDKYXHWWWPBFS-CNNODRBYSA-N |
| XLogP | 3.39 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|