C11H18O4 — CID 101452270
(1S,4R,5R)-1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane (PubChem CID 101452270) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1S,4R,5R)-1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane.
| Compound Name | (1S,4R,5R)-1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 101452270 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (1S,4R,5R)-1,6,6-trimethyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane |
| SMILES | C=C(C)[C@H]1OO[C@@]2(C)OCC(C)(C)[C@H]1O2 |
| InChI | InChI=1S/C11H18O4/c1-7(2)8-9-10(3,4)6-12-11(5,13-9)15-14-8/h8-9H,1,6H2,2-5H3/t8-,9+,11+/m1/s1 |
| InChIKey | HQEMXVDDLHVFQF-YWVKMMECSA-N |
| XLogP | 2.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|