C9H14O4 — CID 24749907
(1R,4R,5R)-1-methyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane (PubChem CID 24749907) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (1R,4R,5R)-1-methyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane.
| Compound Name | (1R,4R,5R)-1-methyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 24749907 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (1R,4R,5R)-1-methyl-4-prop-1-en-2-yl-2,3,8,9-tetraoxabicyclo[3.3.1]nonane |
| SMILES | C=C(C)[C@H]1OO[C@]2(C)OCC[C@H]1O2 |
| InChI | InChI=1S/C9H14O4/c1-6(2)8-7-4-5-10-9(3,11-7)13-12-8/h7-8H,1,4-5H2,2-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | MQQWZAXPHXONBK-IWSPIJDZSA-N |
| XLogP | 1.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|