C14H10BrF2N — CID 101453918
N-benzyl-1-(4-bromo-2,6-difluorophenyl)methanimine (PubChem CID 101453918) has the molecular formula C14H10BrF2N and a molecular weight of 310.14 g/mol. Its IUPAC name is N-benzyl-1-(4-bromo-2,6-difluorophenyl)methanimine.
| Compound Name | N-benzyl-1-(4-bromo-2,6-difluorophenyl)methanimine |
|---|---|
| PubChem CID | 101453918 |
| Molecular Formula | C14H10BrF2N |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-benzyl-1-(4-bromo-2,6-difluorophenyl)methanimine |
| SMILES | Fc1cc(Br)cc(F)c1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C14H10BrF2N/c15-11-6-13(16)12(14(17)7-11)9-18-8-10-4-2-1-3-5-10/h1-7,9H,8H2/b18-9+ |
| InChIKey | RMTMIIQLFGQVAO-GIJQJNRQSA-N |
| XLogP | 4.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|