C15H11F4N — CID 101453924
N-benzyl-1-(2,3,4,5-tetrafluoro-6-methylphenyl)methanimine (PubChem CID 101453924) has the molecular formula C15H11F4N and a molecular weight of 281.25 g/mol. Its IUPAC name is N-benzyl-1-(2,3,4,5-tetrafluoro-6-methylphenyl)methanimine.
| Compound Name | N-benzyl-1-(2,3,4,5-tetrafluoro-6-methylphenyl)methanimine |
|---|---|
| PubChem CID | 101453924 |
| Molecular Formula | C15H11F4N |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-benzyl-1-(2,3,4,5-tetrafluoro-6-methylphenyl)methanimine |
| SMILES | Cc1c(F)c(F)c(F)c(F)c1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C15H11F4N/c1-9-11(13(17)15(19)14(18)12(9)16)8-20-7-10-5-3-2-4-6-10/h2-6,8H,7H2,1H3/b20-8+ |
| InChIKey | NYPFOPRUUXMGNW-DNTJNYDQSA-N |
| XLogP | 4.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|