C23H40O3Si — CID 101455167
(1R,2S,3R,4R)-4,5-dihexyl-7-oxo-3-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 101455167) has the molecular formula C23H40O3Si and a molecular weight of 392.66 g/mol. Its IUPAC name is (1R,2S,3R,4R)-4,5-dihexyl-7-oxo-3-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-4,5-dihexyl-7-oxo-3-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 101455167 |
| Molecular Formula | C23H40O3Si |
| Molecular Weight | 392.66 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (1R,2S,3R,4R)-4,5-dihexyl-7-oxo-3-trimethylsilylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCCCCCC1=C[C@H]2C(=O)[C@]1(CCCCCC)[C@H]([Si](C)(C)C)[C@@H]2C(=O)O |
| InChI | InChI=1S/C23H40O3Si/c1-6-8-10-12-14-17-16-18-19(22(25)26)21(27(3,4)5)23(17,20(18)24)15-13-11-9-7-2/h16,18-19,21H,6-15H2,1-5H3,(H,25,26)/t18-,19-,21-,23-/m1/s1 |
| InChIKey | IYOKPZXHXHELGR-LUBSMZHTSA-N |
| XLogP | 6.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.66 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|