C13H12I2OS — CID 101455669
2-benzyl-4-ethylsulfanyl-3,5-diiodofuran (PubChem CID 101455669) has the molecular formula C13H12I2OS and a molecular weight of 470.11 g/mol. Its IUPAC name is 2-benzyl-4-ethylsulfanyl-3,5-diiodofuran.
| Compound Name | 2-benzyl-4-ethylsulfanyl-3,5-diiodofuran |
|---|---|
| PubChem CID | 101455669 |
| Molecular Formula | C13H12I2OS |
| Molecular Weight | 470.11 g/mol |
| Exact Mass | 469.87 |
| IUPAC Name | 2-benzyl-4-ethylsulfanyl-3,5-diiodofuran |
| SMILES | CCSc1c(I)oc(Cc2ccccc2)c1I |
| InChI | InChI=1S/C13H12I2OS/c1-2-17-12-11(14)10(16-13(12)15)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | DVMUSPPTHYFZMV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.11 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|