C12H13IN2O6S — CID 101456016
(3R,6S)-6-(iodomethyl)-3-methyl-4-(2-nitrophenyl)sulfonylmorpholin-2-one (PubChem CID 101456016) has the molecular formula C12H13IN2O6S and a molecular weight of 440.22 g/mol. Its IUPAC name is (3R,6S)-6-(iodomethyl)-3-methyl-4-(2-nitrophenyl)sulfonylmorpholin-2-one.
| Compound Name | (3R,6S)-6-(iodomethyl)-3-methyl-4-(2-nitrophenyl)sulfonylmorpholin-2-one |
|---|---|
| PubChem CID | 101456016 |
| Molecular Formula | C12H13IN2O6S |
| Molecular Weight | 440.22 g/mol |
| Exact Mass | 439.95 |
| IUPAC Name | (3R,6S)-6-(iodomethyl)-3-methyl-4-(2-nitrophenyl)sulfonylmorpholin-2-one |
| SMILES | C[C@@H]1C(=O)O[C@H](CI)CN1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13IN2O6S/c1-8-12(16)21-9(6-13)7-14(8)22(19,20)11-5-3-2-4-10(11)15(17)18/h2-5,8-9H,6-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | WQLJGAOKYBLZJG-RKDXNWHRSA-N |
| XLogP | 1.33 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|