C39H64O5 — CID 10145631
[3-hydroxy-2-[(9E,11E,13E)-octadeca-9,11,13-trienoyl]oxypropyl] (9E,11E,13E)-octadeca-9,11,13-trienoate (PubChem CID 10145631) has the molecular formula C39H64O5 and a molecular weight of 612.94 g/mol. Its IUPAC name is [3-hydroxy-2-[(9E,11E,13E)-octadeca-9,11,13-trienoyl]oxypropyl] (9E,11E,13E)-octadeca-9,11,13-trienoate.
| Compound Name | [3-hydroxy-2-[(9E,11E,13E)-octadeca-9,11,13-trienoyl]oxypropyl] (9E,11E,13E)-octadeca-9,11,13-trienoate |
|---|---|
| PubChem CID | 10145631 |
| Molecular Formula | C39H64O5 |
| Molecular Weight | 612.94 g/mol |
| Exact Mass | 612.48 |
| IUPAC Name | [3-hydroxy-2-[(9E,11E,13E)-octadeca-9,11,13-trienoyl]oxypropyl] (9E,11E,13E)-octadeca-9,11,13-trienoate |
| SMILES | CCCC/C=C/C=C/C=C/CCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCC/C=C/C=C/C=C/CCCC |
| InChI | InChI=1S/C39H64O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h9-20,37,40H,3-8,21-36H2,1-2H3/b11-9+,12-10+,15-13+,16-14+,19-17+,20-18+ |
| InChIKey | YRXCQVGNSCFRFZ-KYSNBPAQSA-N |
| XLogP | 10.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.94 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|