C29H50O5 — CID 134750270
(2-decanoyloxy-3-hydroxypropyl) (9E,11E,13E)-hexadeca-9,11,13-trienoate (PubChem CID 134750270) has the molecular formula C29H50O5 and a molecular weight of 478.71 g/mol. Its IUPAC name is (2-decanoyloxy-3-hydroxypropyl) (9E,11E,13E)-hexadeca-9,11,13-trienoate.
| Compound Name | (2-decanoyloxy-3-hydroxypropyl) (9E,11E,13E)-hexadeca-9,11,13-trienoate |
|---|---|
| PubChem CID | 134750270 |
| Molecular Formula | C29H50O5 |
| Molecular Weight | 478.71 g/mol |
| Exact Mass | 478.37 |
| IUPAC Name | (2-decanoyloxy-3-hydroxypropyl) (9E,11E,13E)-hexadeca-9,11,13-trienoate |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C29H50O5/c1-3-5-7-9-11-12-13-14-15-16-18-19-21-23-28(31)33-26-27(25-30)34-29(32)24-22-20-17-10-8-6-4-2/h5,7,9,11-13,27,30H,3-4,6,8,10,14-26H2,1-2H3/b7-5+,11-9+,13-12+ |
| InChIKey | MPFWYXHBGSXCHK-NANBLUSISA-N |
| XLogP | 7.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.71 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|