C40H60O5 — CID 134723293
[1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-hydroxypropan-2-yl] (9E,11E,13E,15E,17E)-henicosa-9,11,13,15,17-pentaenoate (PubChem CID 134723293) has the molecular formula C40H60O5 and a molecular weight of 620.92 g/mol. Its IUPAC name is [1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-hydroxypropan-2-yl] (9E,11E,13E,15E,17E)-henicosa-9,11,13,15,17-pentaenoate.
| Compound Name | [1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-hydroxypropan-2-yl] (9E,11E,13E,15E,17E)-henicosa-9,11,13,15,17-pentaenoate |
|---|---|
| PubChem CID | 134723293 |
| Molecular Formula | C40H60O5 |
| Molecular Weight | 620.92 g/mol |
| Exact Mass | 620.44 |
| IUPAC Name | [1-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-hydroxypropan-2-yl] (9E,11E,13E,15E,17E)-henicosa-9,11,13,15,17-pentaenoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OCC(CO)OC(=O)CCCCCCC/C=C/C=C/C=C/C=C/C=C/CCC |
| InChI | InChI=1S/C40H60O5/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-35-40(43)45-38(36-41)37-44-39(42)34-32-30-28-26-24-22-16-14-12-10-8-6-4-2/h6-22,24,38,41H,3-5,23,25-37H2,1-2H3/b8-6+,9-7+,12-10+,13-11+,16-14+,17-15+,19-18+,21-20+,24-22+ |
| InChIKey | CCEHLJVDBJZQPJ-BMXGUQPESA-N |
| XLogP | 10.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.92 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|